C23H37NO6S2 — CID 58144203
7-tert-butylsulfonyl-1-[3-[(2R)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]heptan-2-one (PubChem CID 58144203) has the molecular formula C23H37NO6S2 and a molecular weight of 487.68 g/mol. Its IUPAC name is 7-tert-butylsulfonyl-1-[3-[(2R)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]heptan-2-one.
| Compound Name | 7-tert-butylsulfonyl-1-[3-[(2R)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]heptan-2-one |
|---|---|
| PubChem CID | 58144203 |
| Molecular Formula | C23H37NO6S2 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 7-tert-butylsulfonyl-1-[3-[(2R)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]heptan-2-one |
| SMILES | CC1CN(S(=O)(=O)c2cccc(CC(=O)CCCCCS(=O)(=O)C(C)(C)C)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C23H37NO6S2/c1-18-16-24(17-19(2)30-18)32(28,29)22-12-9-10-20(15-22)14-21(25)11-7-6-8-13-31(26,27)23(3,4)5/h9-10,12,15,18-19H,6-8,11,13-14,16-17H2,1-5H3/t18-,19?/m1/s1 |
| InChIKey | MVEHQPLWFZNYBN-MRTLOADZSA-N |
| XLogP | 3.37 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|