C25H41NO4S — CID 58144400
7-tert-butylsulfonyl-1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,5-dimethylphenyl]heptan-2-one (PubChem CID 58144400) has the molecular formula C25H41NO4S and a molecular weight of 451.67 g/mol. Its IUPAC name is 7-tert-butylsulfonyl-1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,5-dimethylphenyl]heptan-2-one.
| Compound Name | 7-tert-butylsulfonyl-1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,5-dimethylphenyl]heptan-2-one |
|---|---|
| PubChem CID | 58144400 |
| Molecular Formula | C25H41NO4S |
| Molecular Weight | 451.67 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 7-tert-butylsulfonyl-1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,5-dimethylphenyl]heptan-2-one |
| SMILES | Cc1cc(N2C[C@@H](C)O[C@@H](C)C2)c(C)cc1CC(=O)CCCCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C25H41NO4S/c1-18-14-24(26-16-20(3)30-21(4)17-26)19(2)13-22(18)15-23(27)11-9-8-10-12-31(28,29)25(5,6)7/h13-14,20-21H,8-12,15-17H2,1-7H3/t20-,21+ |
| InChIKey | BJIJQZHENDBBSN-OYRHEFFESA-N |
| XLogP | 4.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|