C22H34FNO4S — CID 58144094
1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-7-propan-2-ylsulfonylheptan-2-one (PubChem CID 58144094) has the molecular formula C22H34FNO4S and a molecular weight of 427.58 g/mol. Its IUPAC name is 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-7-propan-2-ylsulfonylheptan-2-one.
| Compound Name | 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-7-propan-2-ylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58144094 |
| Molecular Formula | C22H34FNO4S |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-7-propan-2-ylsulfonylheptan-2-one |
| SMILES | CC(C)S(=O)(=O)CCCCCC(=O)Cc1ccc(N2C[C@@H](C)O[C@@H](C)C2)cc1F |
| InChI | InChI=1S/C22H34FNO4S/c1-16(2)29(26,27)11-7-5-6-8-21(25)12-19-9-10-20(13-22(19)23)24-14-17(3)28-18(4)15-24/h9-10,13,16-18H,5-8,11-12,14-15H2,1-4H3/t17-,18+ |
| InChIKey | YDTDQYARBGJAHA-HDICACEKSA-N |
| XLogP | 3.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|