C22H36FNO3S — CID 59546142
(2R,6S)-4-[3-fluoro-4-(7-propan-2-ylsulfonylheptyl)phenyl]-2,6-dimethylmorpholine (PubChem CID 59546142) has the molecular formula C22H36FNO3S and a molecular weight of 413.60 g/mol. Its IUPAC name is (2R,6S)-4-[3-fluoro-4-(7-propan-2-ylsulfonylheptyl)phenyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-[3-fluoro-4-(7-propan-2-ylsulfonylheptyl)phenyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 59546142 |
| Molecular Formula | C22H36FNO3S |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | (2R,6S)-4-[3-fluoro-4-(7-propan-2-ylsulfonylheptyl)phenyl]-2,6-dimethylmorpholine |
| SMILES | CC(C)S(=O)(=O)CCCCCCCc1ccc(N2C[C@@H](C)O[C@@H](C)C2)cc1F |
| InChI | InChI=1S/C22H36FNO3S/c1-17(2)28(25,26)13-9-7-5-6-8-10-20-11-12-21(14-22(20)23)24-15-18(3)27-19(4)16-24/h11-12,14,17-19H,5-10,13,15-16H2,1-4H3/t18-,19+ |
| InChIKey | CBSBDPNCZRWQBL-KDURUIRLSA-N |
| XLogP | 4.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|