C22H37NO5S2 — CID 161233704
(2R,6S)-2,6-dimethyl-4-[4-(7-propan-2-ylsulfonylheptyl)phenyl]sulfonylmorpholine (PubChem CID 161233704) has the molecular formula C22H37NO5S2 and a molecular weight of 459.67 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-[4-(7-propan-2-ylsulfonylheptyl)phenyl]sulfonylmorpholine.
| Compound Name | (2R,6S)-2,6-dimethyl-4-[4-(7-propan-2-ylsulfonylheptyl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 161233704 |
| Molecular Formula | C22H37NO5S2 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-[4-(7-propan-2-ylsulfonylheptyl)phenyl]sulfonylmorpholine |
| SMILES | CC(C)S(=O)(=O)CCCCCCCc1ccc(S(=O)(=O)N2C[C@@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C22H37NO5S2/c1-18(2)29(24,25)15-9-7-5-6-8-10-21-11-13-22(14-12-21)30(26,27)23-16-19(3)28-20(4)17-23/h11-14,18-20H,5-10,15-17H2,1-4H3/t19-,20+ |
| InChIKey | VFBVWEUJJWBZMW-BGYRXZFFSA-N |
| XLogP | 3.80 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|