C19H33NO2S — CID 59545884
N,N-dimethyl-4-(8-propan-2-ylsulfonyloctyl)aniline (PubChem CID 59545884) has the molecular formula C19H33NO2S and a molecular weight of 339.55 g/mol. Its IUPAC name is N,N-dimethyl-4-(8-propan-2-ylsulfonyloctyl)aniline.
| Compound Name | N,N-dimethyl-4-(8-propan-2-ylsulfonyloctyl)aniline |
|---|---|
| PubChem CID | 59545884 |
| Molecular Formula | C19H33NO2S |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N,N-dimethyl-4-(8-propan-2-ylsulfonyloctyl)aniline |
| SMILES | CC(C)S(=O)(=O)CCCCCCCCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H33NO2S/c1-17(2)23(21,22)16-10-8-6-5-7-9-11-18-12-14-19(15-13-18)20(3)4/h12-15,17H,5-11,16H2,1-4H3 |
| InChIKey | LVMPXGPMHIKSDF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|