C20H34O3S — CID 161332451
1-butoxy-3-(7-propan-2-ylsulfonylheptyl)benzene (PubChem CID 161332451) has the molecular formula C20H34O3S and a molecular weight of 354.56 g/mol. Its IUPAC name is 1-butoxy-3-(7-propan-2-ylsulfonylheptyl)benzene.
| Compound Name | 1-butoxy-3-(7-propan-2-ylsulfonylheptyl)benzene |
|---|---|
| PubChem CID | 161332451 |
| Molecular Formula | C20H34O3S |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-butoxy-3-(7-propan-2-ylsulfonylheptyl)benzene |
| SMILES | CCCCOc1cccc(CCCCCCCS(=O)(=O)C(C)C)c1 |
| InChI | InChI=1S/C20H34O3S/c1-4-5-15-23-20-14-11-13-19(17-20)12-9-7-6-8-10-16-24(21,22)18(2)3/h11,13-14,17-18H,4-10,12,15-16H2,1-3H3 |
| InChIKey | IOJODXRBQOJFTO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|