C32H50O5 — CID 3007329
4-[6-[3-(8-oxo-7-propanoyldecoxy)phenyl]hexyl]heptane-3,5-dione (PubChem CID 3007329) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is 4-[6-[3-(8-oxo-7-propanoyldecoxy)phenyl]hexyl]heptane-3,5-dione.
| Compound Name | 4-[6-[3-(8-oxo-7-propanoyldecoxy)phenyl]hexyl]heptane-3,5-dione |
|---|---|
| PubChem CID | 3007329 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | 4-[6-[3-(8-oxo-7-propanoyldecoxy)phenyl]hexyl]heptane-3,5-dione |
| SMILES | CCC(=O)C(CCCCCCOc1cccc(CCCCCCC(C(=O)CC)C(=O)CC)c1)C(=O)CC |
| InChI | InChI=1S/C32H50O5/c1-5-29(33)27(30(34)6-2)21-14-10-9-13-18-25-19-17-20-26(24-25)37-23-16-12-11-15-22-28(31(35)7-3)32(36)8-4/h17,19-20,24,27-28H,5-16,18,21-23H2,1-4H3 |
| InChIKey | UBPKWESDRKEZFP-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|