C25H40O5 — CID 21429322
4-[6-[4-(3-propoxypropoxy)phenoxy]hexyl]heptane-3,5-dione (PubChem CID 21429322) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is 4-[6-[4-(3-propoxypropoxy)phenoxy]hexyl]heptane-3,5-dione.
| Compound Name | 4-[6-[4-(3-propoxypropoxy)phenoxy]hexyl]heptane-3,5-dione |
|---|---|
| PubChem CID | 21429322 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 4-[6-[4-(3-propoxypropoxy)phenoxy]hexyl]heptane-3,5-dione |
| SMILES | CCCOCCCOc1ccc(OCCCCCCC(C(=O)CC)C(=O)CC)cc1 |
| InChI | InChI=1S/C25H40O5/c1-4-17-28-18-11-20-30-22-15-13-21(14-16-22)29-19-10-8-7-9-12-23(24(26)5-2)25(27)6-3/h13-16,23H,4-12,17-20H2,1-3H3 |
| InChIKey | SHXDNHGJXDQBAH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|