C26H38N2O4 — CID 67681566
2-[2-[4-(4-propoxybutoxy)phenyl]pyrimidin-5-yl]nonanoic acid (PubChem CID 67681566) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is 2-[2-[4-(4-propoxybutoxy)phenyl]pyrimidin-5-yl]nonanoic acid.
| Compound Name | 2-[2-[4-(4-propoxybutoxy)phenyl]pyrimidin-5-yl]nonanoic acid |
|---|---|
| PubChem CID | 67681566 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 2-[2-[4-(4-propoxybutoxy)phenyl]pyrimidin-5-yl]nonanoic acid |
| SMILES | CCCCCCCC(C(=O)O)c1cnc(-c2ccc(OCCCCOCCC)cc2)nc1 |
| InChI | InChI=1S/C26H38N2O4/c1-3-5-6-7-8-11-24(26(29)30)22-19-27-25(28-20-22)21-12-14-23(15-13-21)32-18-10-9-17-31-16-4-2/h12-15,19-20,24H,3-11,16-18H2,1-2H3,(H,29,30) |
| InChIKey | YDBAITXFGDOLJN-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|