C28H42N2O4 — CID 67681455
2-[2-[4-(6-methoxyhexoxy)phenyl]pyrimidin-5-yl]undecanoic acid (PubChem CID 67681455) has the molecular formula C28H42N2O4 and a molecular weight of 470.65 g/mol. Its IUPAC name is 2-[2-[4-(6-methoxyhexoxy)phenyl]pyrimidin-5-yl]undecanoic acid.
| Compound Name | 2-[2-[4-(6-methoxyhexoxy)phenyl]pyrimidin-5-yl]undecanoic acid |
|---|---|
| PubChem CID | 67681455 |
| Molecular Formula | C28H42N2O4 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | 2-[2-[4-(6-methoxyhexoxy)phenyl]pyrimidin-5-yl]undecanoic acid |
| SMILES | CCCCCCCCCC(C(=O)O)c1cnc(-c2ccc(OCCCCCCOC)cc2)nc1 |
| InChI | InChI=1S/C28H42N2O4/c1-3-4-5-6-7-8-11-14-26(28(31)32)24-21-29-27(30-22-24)23-15-17-25(18-16-23)34-20-13-10-9-12-19-33-2/h15-18,21-22,26H,3-14,19-20H2,1-2H3,(H,31,32) |
| InChIKey | JCJUPTUTCRUJOR-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|