About 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate
3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate (PubChem CID 23180688) has the molecular formula C28H42N2O3
and a molecular weight of 454.66 g/mol. Its IUPAC name is 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate |
| PubChem CID | 23180688 |
| Molecular Formula | C28H42N2O3 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ncc(C(=O)OCCC(C)CCCCC)cn2)cc1 |
| InChI | InChI=1S/C28H42N2O3/c1-4-6-8-9-10-12-19-32-26-16-14-24(15-17-26)27-29-21-25(22-30-27)28(31)33-20-18-23(3)13-11-7-5-2/h14-17,21-23H,4-13,18-20H2,1-3H3 |
| InChIKey | PVZGYQRUNLVRTB-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate?
The IUPAC name of 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate (CID 23180688) is 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate.
What is the SMILES notation for 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate?
The canonical SMILES for 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate is CCCCCCCCOc1ccc(-c2ncc(C(=O)OCCC(C)CCCCC)cn2)cc1.
What is the InChIKey of 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate?
The InChIKey is PVZGYQRUNLVRTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H42N2O3/c1-4-6-8-9-10-12-19-32-26-16-14-24(15-17-26)27-29-21-25(22-30-27)28(31)33-20-18-23(3)13-11-7-5-2/h14-17,21-23H,4-13,18-20H2,1-3H3.
What are the key properties of 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate?
3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate has a molecular weight of 454.66 g/mol, XLogP of 7.65, 17 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyloctyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate is sourced from PubChem (CID 23180688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).