About 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate
6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate (PubChem CID 23180651) has the molecular formula C29H43NO3
and a molecular weight of 453.67 g/mol. Its IUPAC name is 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate |
| PubChem CID | 23180651 |
| Molecular Formula | C29H43NO3 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)OCCCCCC(C)CC)cn2)cc1 |
| InChI | InChI=1S/C29H43NO3/c1-4-6-7-8-9-12-21-32-27-18-15-25(16-19-27)28-20-17-26(23-30-28)29(31)33-22-13-10-11-14-24(3)5-2/h15-20,23-24H,4-14,21-22H2,1-3H3 |
| InChIKey | SRBXBFROXTWXLG-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate?
The IUPAC name of 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate (CID 23180651) is 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate.
What is the SMILES notation for 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate?
The canonical SMILES for 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate is CCCCCCCCOc1ccc(-c2ccc(C(=O)OCCCCCC(C)CC)cn2)cc1.
What is the InChIKey of 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate?
The InChIKey is SRBXBFROXTWXLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H43NO3/c1-4-6-7-8-9-12-21-32-27-18-15-25(16-19-27)28-20-17-26(23-30-28)29(31)33-22-13-10-11-14-24(3)5-2/h15-20,23-24H,4-14,21-22H2,1-3H3.
What are the key properties of 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate?
6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate has a molecular weight of 453.67 g/mol, XLogP of 8.25, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyloctyl 6-(4-octoxyphenyl)pyridine-3-carboxylate is sourced from PubChem (CID 23180651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).