C31H44O5 — CID 139882304
[4-(3,7-dimethyloctoxycarbonyl)phenyl] 4-heptoxybenzoate (PubChem CID 139882304) has the molecular formula C31H44O5 and a molecular weight of 496.69 g/mol. Its IUPAC name is [4-(3,7-dimethyloctoxycarbonyl)phenyl] 4-heptoxybenzoate.
| Compound Name | [4-(3,7-dimethyloctoxycarbonyl)phenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 139882304 |
| Molecular Formula | C31H44O5 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | [4-(3,7-dimethyloctoxycarbonyl)phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)OCCC(C)CCCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H44O5/c1-5-6-7-8-9-22-34-28-17-13-27(14-18-28)31(33)36-29-19-15-26(16-20-29)30(32)35-23-21-25(4)12-10-11-24(2)3/h13-20,24-25H,5-12,21-23H2,1-4H3 |
| InChIKey | NYSXMHADPLTKHC-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|