C30H34O6 — CID 138718417
[4-(4-hydroxyphenoxy)carbonylphenyl] 4-[(3S)-3,7-dimethyloctoxy]benzoate (PubChem CID 138718417) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is [4-(4-hydroxyphenoxy)carbonylphenyl] 4-[(3S)-3,7-dimethyloctoxy]benzoate.
| Compound Name | [4-(4-hydroxyphenoxy)carbonylphenyl] 4-[(3S)-3,7-dimethyloctoxy]benzoate |
|---|---|
| PubChem CID | 138718417 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | [4-(4-hydroxyphenoxy)carbonylphenyl] 4-[(3S)-3,7-dimethyloctoxy]benzoate |
| SMILES | CC(C)CCC[C@H](C)CCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H34O6/c1-21(2)5-4-6-22(3)19-20-34-26-13-7-23(8-14-26)29(32)35-27-15-9-24(10-16-27)30(33)36-28-17-11-25(31)12-18-28/h7-18,21-22,31H,4-6,19-20H2,1-3H3/t22-/m0/s1 |
| InChIKey | ZYPOBTSNSFXSTQ-QFIPXVFZSA-N |
| XLogP | 7.06 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|