C53H62N4O8 — CID 102470579
3,5-bis[[4-[[4-[(3R)-3,7-dimethyloctoxy]phenyl]diazenyl]benzoyl]oxy]benzoic acid (PubChem CID 102470579) has the molecular formula C53H62N4O8 and a molecular weight of 883.10 g/mol. Its IUPAC name is 3,5-bis[[4-[[4-[(3R)-3,7-dimethyloctoxy]phenyl]diazenyl]benzoyl]oxy]benzoic acid.
| Compound Name | 3,5-bis[[4-[[4-[(3R)-3,7-dimethyloctoxy]phenyl]diazenyl]benzoyl]oxy]benzoic acid |
|---|---|
| PubChem CID | 102470579 |
| Molecular Formula | C53H62N4O8 |
| Molecular Weight | 883.10 g/mol |
| Exact Mass | 882.46 |
| IUPAC Name | 3,5-bis[[4-[[4-[(3R)-3,7-dimethyloctoxy]phenyl]diazenyl]benzoyl]oxy]benzoic acid |
| SMILES | CC(C)CCC[C@@H](C)CCOc1ccc(/N=N/c2ccc(C(=O)Oc3cc(OC(=O)c4ccc(/N=N/c5ccc(OCC[C@H](C)CCCC(C)C)cc5)cc4)cc(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C53H62N4O8/c1-36(2)9-7-11-38(5)29-31-62-47-25-21-45(22-26-47)56-54-43-17-13-40(14-18-43)52(60)64-49-33-42(51(58)59)34-50(35-49)65-53(61)41-15-19-44(20-16-41)55-57-46-23-27-48(28-24-46)63-32-30-39(6)12-8-10-37(3)4/h13-28,33-39H,7-12,29-32H2,1-6H3,(H,58,59)/b56-54+,57-55+/t38-,39-/m1/s1 |
| InChIKey | XNEHEQKQKSGHLM-JKUJJCHSSA-N |
| XLogP | 15.12 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.10 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|