C60H67ClN2O6 — CID 101400030
[2-chloro-4-[3-[4-[[4-(3,7-dimethyloctoxy)phenyl]iminomethyl]benzoyl]oxyphenyl]phenyl] 4-[[4-(3,7-dimethyloctoxy)phenyl]iminomethyl]benzoate (PubChem CID 101400030) has the molecular formula C60H67ClN2O6 and a molecular weight of 947.66 g/mol. Its IUPAC name is [2-chloro-4-[3-[4-[[4-(3,7-dimethyloctoxy)phenyl]iminomethyl]benzoyl]oxyphenyl]phenyl] 4-[[4-(3,7-dimethyloctoxy)phenyl]iminomethyl]benzoate.
| Compound Name | [2-chloro-4-[3-[4-[[4-(3,7-dimethyloctoxy)phenyl]iminomethyl]benzoyl]oxyphenyl]phenyl] 4-[[4-(3,7-dimethyloctoxy)phenyl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 101400030 |
| Molecular Formula | C60H67ClN2O6 |
| Molecular Weight | 947.66 g/mol |
| Exact Mass | 946.47 |
| IUPAC Name | [2-chloro-4-[3-[4-[[4-(3,7-dimethyloctoxy)phenyl]iminomethyl]benzoyl]oxyphenyl]phenyl] 4-[[4-(3,7-dimethyloctoxy)phenyl]iminomethyl]benzoate |
| SMILES | CC(C)CCCC(C)CCOc1ccc(/N=C/c2ccc(C(=O)Oc3cccc(-c4ccc(OC(=O)c5ccc(/C=N/c6ccc(OCCC(C)CCCC(C)C)cc6)cc5)c(Cl)c4)c3)cc2)cc1 |
| InChI | InChI=1S/C60H67ClN2O6/c1-42(2)10-7-12-44(5)34-36-66-54-29-25-52(26-30-54)62-40-46-16-20-48(21-17-46)59(64)68-56-15-9-14-50(38-56)51-24-33-58(57(61)39-51)69-60(65)49-22-18-47(19-23-49)41-63-53-27-31-55(32-28-53)67-37-35-45(6)13-8-11-43(3)4/h9,14-33,38-45H,7-8,10-13,34-37H2,1-6H3/b62-40+,63-41+ |
| InChIKey | UOZHJNDRZFBBPX-VHVRFMDKSA-N |
| XLogP | 16.41 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.66 |
| LogP ≤ 5 | 16.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|