C28H30ClNO3 — CID 101042828
(2-chlorophenyl) 4-[(4-octoxyphenyl)methylideneamino]benzoate (PubChem CID 101042828) has the molecular formula C28H30ClNO3 and a molecular weight of 464.01 g/mol. Its IUPAC name is (2-chlorophenyl) 4-[(4-octoxyphenyl)methylideneamino]benzoate.
| Compound Name | (2-chlorophenyl) 4-[(4-octoxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 101042828 |
| Molecular Formula | C28H30ClNO3 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (2-chlorophenyl) 4-[(4-octoxyphenyl)methylideneamino]benzoate |
| SMILES | CCCCCCCCOc1ccc(/C=N/c2ccc(C(=O)Oc3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H30ClNO3/c1-2-3-4-5-6-9-20-32-25-18-12-22(13-19-25)21-30-24-16-14-23(15-17-24)28(31)33-27-11-8-7-10-26(27)29/h7-8,10-19,21H,2-6,9,20H2,1H3/b30-21+ |
| InChIKey | LXBDZVMMHDPIMK-MWAVMZGNSA-N |
| XLogP | 8.05 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|