C28H31NO3 — CID 101042811
(2-methylphenyl) 4-[(4-heptoxyphenyl)methylideneamino]benzoate (PubChem CID 101042811) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is (2-methylphenyl) 4-[(4-heptoxyphenyl)methylideneamino]benzoate.
| Compound Name | (2-methylphenyl) 4-[(4-heptoxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 101042811 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (2-methylphenyl) 4-[(4-heptoxyphenyl)methylideneamino]benzoate |
| SMILES | CCCCCCCOc1ccc(/C=N/c2ccc(C(=O)Oc3ccccc3C)cc2)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-3-4-5-6-9-20-31-26-18-12-23(13-19-26)21-29-25-16-14-24(15-17-25)28(30)32-27-11-8-7-10-22(27)2/h7-8,10-19,21H,3-6,9,20H2,1-2H3/b29-21+ |
| InChIKey | FQUPPOALAJSBLR-XHLNEMQHSA-N |
| XLogP | 7.31 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|