C27H28FNO3 — CID 101042846
(2-fluorophenyl) 4-[(4-heptoxyphenyl)methylideneamino]benzoate (PubChem CID 101042846) has the molecular formula C27H28FNO3 and a molecular weight of 433.52 g/mol. Its IUPAC name is (2-fluorophenyl) 4-[(4-heptoxyphenyl)methylideneamino]benzoate.
| Compound Name | (2-fluorophenyl) 4-[(4-heptoxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 101042846 |
| Molecular Formula | C27H28FNO3 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (2-fluorophenyl) 4-[(4-heptoxyphenyl)methylideneamino]benzoate |
| SMILES | CCCCCCCOc1ccc(/C=N/c2ccc(C(=O)Oc3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C27H28FNO3/c1-2-3-4-5-8-19-31-24-17-11-21(12-18-24)20-29-23-15-13-22(14-16-23)27(30)32-26-10-7-6-9-25(26)28/h6-7,9-18,20H,2-5,8,19H2,1H3/b29-20+ |
| InChIKey | CSMNVRUZCMCLFA-ZTKZIYFRSA-N |
| XLogP | 7.14 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|