C53H59N3O6 — CID 101269644
[2-cyano-3-[4-[(4-nonoxyphenyl)methylideneamino]benzoyl]oxyphenyl] 4-[(4-nonoxyphenyl)methylideneamino]benzoate (PubChem CID 101269644) has the molecular formula C53H59N3O6 and a molecular weight of 834.07 g/mol. Its IUPAC name is [2-cyano-3-[4-[(4-nonoxyphenyl)methylideneamino]benzoyl]oxyphenyl] 4-[(4-nonoxyphenyl)methylideneamino]benzoate.
| Compound Name | [2-cyano-3-[4-[(4-nonoxyphenyl)methylideneamino]benzoyl]oxyphenyl] 4-[(4-nonoxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 101269644 |
| Molecular Formula | C53H59N3O6 |
| Molecular Weight | 834.07 g/mol |
| Exact Mass | 833.44 |
| IUPAC Name | [2-cyano-3-[4-[(4-nonoxyphenyl)methylideneamino]benzoyl]oxyphenyl] 4-[(4-nonoxyphenyl)methylideneamino]benzoate |
| SMILES | CCCCCCCCCOc1ccc(/C=N/c2ccc(C(=O)Oc3cccc(OC(=O)c4ccc(/N=C/c5ccc(OCCCCCCCCC)cc5)cc4)c3C#N)cc2)cc1 |
| InChI | InChI=1S/C53H59N3O6/c1-3-5-7-9-11-13-15-36-59-47-32-20-41(21-33-47)39-55-45-28-24-43(25-29-45)52(57)61-50-18-17-19-51(49(50)38-54)62-53(58)44-26-30-46(31-27-44)56-40-42-22-34-48(35-23-42)60-37-16-14-12-10-8-6-4-2/h17-35,39-40H,3-16,36-37H2,1-2H3/b55-39+,56-40+ |
| InChIKey | VUCGJWZYDKBCBD-FVBLWZQFSA-N |
| XLogP | 13.76 |
| TPSA | 119.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.07 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|