C57H63N3O8 — CID 101387991
decyl 4-[[4-[2-cyano-3-[4-[(4-decoxycarbonylphenyl)methylideneamino]benzoyl]oxyphenoxy]carbonylphenyl]iminomethyl]benzoate (PubChem CID 101387991) has the molecular formula C57H63N3O8 and a molecular weight of 918.14 g/mol. Its IUPAC name is decyl 4-[[4-[2-cyano-3-[4-[(4-decoxycarbonylphenyl)methylideneamino]benzoyl]oxyphenoxy]carbonylphenyl]iminomethyl]benzoate.
| Compound Name | decyl 4-[[4-[2-cyano-3-[4-[(4-decoxycarbonylphenyl)methylideneamino]benzoyl]oxyphenoxy]carbonylphenyl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 101387991 |
| Molecular Formula | C57H63N3O8 |
| Molecular Weight | 918.14 g/mol |
| Exact Mass | 917.46 |
| IUPAC Name | decyl 4-[[4-[2-cyano-3-[4-[(4-decoxycarbonylphenyl)methylideneamino]benzoyl]oxyphenoxy]carbonylphenyl]iminomethyl]benzoate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc(/C=N/c2ccc(C(=O)Oc3cccc(OC(=O)c4ccc(/N=C/c5ccc(C(=O)OCCCCCCCCCC)cc5)cc4)c3C#N)cc2)cc1 |
| InChI | InChI=1S/C57H63N3O8/c1-3-5-7-9-11-13-15-17-38-65-54(61)45-26-22-43(23-27-45)41-59-49-34-30-47(31-35-49)56(63)67-52-20-19-21-53(51(52)40-58)68-57(64)48-32-36-50(37-33-48)60-42-44-24-28-46(29-25-44)55(62)66-39-18-16-14-12-10-8-6-4-2/h19-37,41-42H,3-18,38-39H2,1-2H3/b59-41+,60-42+ |
| InChIKey | BQZRUOPDKINMFX-KOFZYJMNSA-N |
| XLogP | 14.09 |
| TPSA | 153.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.14 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|