C25H25NO2 — CID 71325634
pentyl 4-[(4-phenylphenyl)methylideneamino]benzoate (PubChem CID 71325634) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is pentyl 4-[(4-phenylphenyl)methylideneamino]benzoate.
| Compound Name | pentyl 4-[(4-phenylphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 71325634 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | pentyl 4-[(4-phenylphenyl)methylideneamino]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(/N=C/c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H25NO2/c1-2-3-7-18-28-25(27)23-14-16-24(17-15-23)26-19-20-10-12-22(13-11-20)21-8-5-4-6-9-21/h4-6,8-17,19H,2-3,7,18H2,1H3/b26-19+ |
| InChIKey | RWBBERNYQIMNJH-LGUFXXKBSA-N |
| XLogP | 6.45 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|