C28H39NO5 — CID 101349511
2-(2-ethoxyethoxy)ethyl 4-[(4-octoxyphenyl)iminomethyl]benzoate (PubChem CID 101349511) has the molecular formula C28H39NO5 and a molecular weight of 469.62 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl 4-[(4-octoxyphenyl)iminomethyl]benzoate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl 4-[(4-octoxyphenyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 101349511 |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl 4-[(4-octoxyphenyl)iminomethyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(/N=C/c2ccc(C(=O)OCCOCCOCC)cc2)cc1 |
| InChI | InChI=1S/C28H39NO5/c1-3-5-6-7-8-9-18-33-27-16-14-26(15-17-27)29-23-24-10-12-25(13-11-24)28(30)34-22-21-32-20-19-31-4-2/h10-17,23H,3-9,18-22H2,1-2H3/b29-23+ |
| InChIKey | UAHYJQVBZKIUSJ-BYNJWEBRSA-N |
| XLogP | 6.39 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|