C57H79NO7 — CID 101016526
[2-(4-decoxybenzoyl)oxy-4-[(4-decoxyphenyl)iminomethyl]phenyl] 4-decoxybenzoate (PubChem CID 101016526) has the molecular formula C57H79NO7 and a molecular weight of 890.26 g/mol. Its IUPAC name is [2-(4-decoxybenzoyl)oxy-4-[(4-decoxyphenyl)iminomethyl]phenyl] 4-decoxybenzoate.
| Compound Name | [2-(4-decoxybenzoyl)oxy-4-[(4-decoxyphenyl)iminomethyl]phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 101016526 |
| Molecular Formula | C57H79NO7 |
| Molecular Weight | 890.26 g/mol |
| Exact Mass | 889.59 |
| IUPAC Name | [2-(4-decoxybenzoyl)oxy-4-[(4-decoxyphenyl)iminomethyl]phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(/N=C/c2ccc(OC(=O)c3ccc(OCCCCCCCCCC)cc3)c(OC(=O)c3ccc(OCCCCCCCCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C57H79NO7/c1-4-7-10-13-16-19-22-25-42-61-51-35-29-48(30-36-51)56(59)64-54-41-28-47(46-58-50-33-39-53(40-34-50)63-44-27-24-21-18-15-12-9-6-3)45-55(54)65-57(60)49-31-37-52(38-32-49)62-43-26-23-20-17-14-11-8-5-2/h28-41,45-46H,4-27,42-44H2,1-3H3/b58-46+ |
| InChIKey | VAFGUHPVYULBEX-WFYRFIFLSA-N |
| XLogP | 16.43 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.26 |
| LogP ≤ 5 | 16.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|