C33H35NO4 — CID 101084547
[2-methoxy-4-(naphthalen-2-yliminomethyl)phenyl] 4-octoxybenzoate (PubChem CID 101084547) has the molecular formula C33H35NO4 and a molecular weight of 509.65 g/mol. Its IUPAC name is [2-methoxy-4-(naphthalen-2-yliminomethyl)phenyl] 4-octoxybenzoate.
| Compound Name | [2-methoxy-4-(naphthalen-2-yliminomethyl)phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 101084547 |
| Molecular Formula | C33H35NO4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | [2-methoxy-4-(naphthalen-2-yliminomethyl)phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc4ccccc4c3)cc2OC)cc1 |
| InChI | InChI=1S/C33H35NO4/c1-3-4-5-6-7-10-21-37-30-18-15-27(16-19-30)33(35)38-31-20-13-25(22-32(31)36-2)24-34-29-17-14-26-11-8-9-12-28(26)23-29/h8-9,11-20,22-24H,3-7,10,21H2,1-2H3/b34-24+ |
| InChIKey | YTNCYTGOFVCPLV-JGRMKTMXSA-N |
| XLogP | 8.56 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|