C24H30O5 — CID 141048785
2-[4-(3,7-dimethyloctoxy)phenyl]terephthalic acid (PubChem CID 141048785) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[4-(3,7-dimethyloctoxy)phenyl]terephthalic acid.
| Compound Name | 2-[4-(3,7-dimethyloctoxy)phenyl]terephthalic acid |
|---|---|
| PubChem CID | 141048785 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[4-(3,7-dimethyloctoxy)phenyl]terephthalic acid |
| SMILES | CC(C)CCCC(C)CCOc1ccc(-c2cc(C(=O)O)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H30O5/c1-16(2)5-4-6-17(3)13-14-29-20-10-7-18(8-11-20)22-15-19(23(25)26)9-12-21(22)24(27)28/h7-12,15-17H,4-6,13-14H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | MBPQJSCSQKRSGA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |