C29H32O6 — CID 175121363
2-[4-[4-(8-hydroxyoctoxy)benzoyl]oxyphenyl]-4-methylbenzoic acid (PubChem CID 175121363) has the molecular formula C29H32O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-[4-[4-(8-hydroxyoctoxy)benzoyl]oxyphenyl]-4-methylbenzoic acid.
| Compound Name | 2-[4-[4-(8-hydroxyoctoxy)benzoyl]oxyphenyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 175121363 |
| Molecular Formula | C29H32O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-[4-[4-(8-hydroxyoctoxy)benzoyl]oxyphenyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(-c2ccc(OC(=O)c3ccc(OCCCCCCCCO)cc3)cc2)c1 |
| InChI | InChI=1S/C29H32O6/c1-21-8-17-26(28(31)32)27(20-21)22-9-15-25(16-10-22)35-29(33)23-11-13-24(14-12-23)34-19-7-5-3-2-4-6-18-30/h8-17,20,30H,2-7,18-19H2,1H3,(H,31,32) |
| InChIKey | OCWLWTYUOWSAPU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|