C41H60N2O4 — CID 142690223
4-[2,5-dimethyl-4-(8-methylnonoxy)phenoxy]-2-[4-(3,7-dimethyloctoxy)phenyl]benzohydrazide (PubChem CID 142690223) has the molecular formula C41H60N2O4 and a molecular weight of 644.94 g/mol. Its IUPAC name is 4-[2,5-dimethyl-4-(8-methylnonoxy)phenoxy]-2-[4-(3,7-dimethyloctoxy)phenyl]benzohydrazide.
| Compound Name | 4-[2,5-dimethyl-4-(8-methylnonoxy)phenoxy]-2-[4-(3,7-dimethyloctoxy)phenyl]benzohydrazide |
|---|---|
| PubChem CID | 142690223 |
| Molecular Formula | C41H60N2O4 |
| Molecular Weight | 644.94 g/mol |
| Exact Mass | 644.46 |
| IUPAC Name | 4-[2,5-dimethyl-4-(8-methylnonoxy)phenoxy]-2-[4-(3,7-dimethyloctoxy)phenyl]benzohydrazide |
| SMILES | Cc1cc(Oc2ccc(C(=O)NN)c(-c3ccc(OCCC(C)CCCC(C)C)cc3)c2)c(C)cc1OCCCCCCCC(C)C |
| InChI | InChI=1S/C41H60N2O4/c1-29(2)14-11-9-8-10-12-24-46-39-26-33(7)40(27-32(39)6)47-36-21-22-37(41(44)43-42)38(28-36)34-17-19-35(20-18-34)45-25-23-31(5)16-13-15-30(3)4/h17-22,26-31H,8-16,23-25,42H2,1-7H3,(H,43,44) |
| InChIKey | GMNWQKWXNLYBHM-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.94 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|