C47H88O3 — CID 56940895
[2,4-bis(3,7,11,15-tetramethylhexadecoxy)phenyl]methanol (PubChem CID 56940895) has the molecular formula C47H88O3 and a molecular weight of 701.22 g/mol. Its IUPAC name is [2,4-bis(3,7,11,15-tetramethylhexadecoxy)phenyl]methanol.
| Compound Name | [2,4-bis(3,7,11,15-tetramethylhexadecoxy)phenyl]methanol |
|---|---|
| PubChem CID | 56940895 |
| Molecular Formula | C47H88O3 |
| Molecular Weight | 701.22 g/mol |
| Exact Mass | 700.67 |
| IUPAC Name | [2,4-bis(3,7,11,15-tetramethylhexadecoxy)phenyl]methanol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCOc1ccc(CO)c(OCCC(C)CCCC(C)CCCC(C)CCCC(C)C)c1 |
| InChI | InChI=1S/C47H88O3/c1-37(2)17-11-19-39(5)21-13-23-41(7)25-15-27-43(9)31-33-49-46-30-29-45(36-48)47(35-46)50-34-32-44(10)28-16-26-42(8)24-14-22-40(6)20-12-18-38(3)4/h29-30,35,37-44,48H,11-28,31-34,36H2,1-10H3 |
| InChIKey | NZCVCWXHHVYOKQ-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.22 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |