C26H44Br2O2 — CID 22174235
1,4-dibromo-2,5-bis(3,7-dimethyloctoxy)benzene (PubChem CID 22174235) has the molecular formula C26H44Br2O2 and a molecular weight of 548.44 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis(3,7-dimethyloctoxy)benzene.
| Compound Name | 1,4-dibromo-2,5-bis(3,7-dimethyloctoxy)benzene |
|---|---|
| PubChem CID | 22174235 |
| Molecular Formula | C26H44Br2O2 |
| Molecular Weight | 548.44 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 1,4-dibromo-2,5-bis(3,7-dimethyloctoxy)benzene |
| SMILES | CC(C)CCCC(C)CCOc1cc(Br)c(OCCC(C)CCCC(C)C)cc1Br |
| InChI | InChI=1S/C26H44Br2O2/c1-19(2)9-7-11-21(5)13-15-29-25-17-24(28)26(18-23(25)27)30-16-14-22(6)12-8-10-20(3)4/h17-22H,7-16H2,1-6H3 |
| InChIKey | DSISBFGKIOFXPJ-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.44 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |