C47H89NO2 — CID 22974817
N-methyl-3,4-bis(3,7,11,15-tetramethylhexadecoxy)aniline (PubChem CID 22974817) has the molecular formula C47H89NO2 and a molecular weight of 700.23 g/mol. Its IUPAC name is N-methyl-3,4-bis(3,7,11,15-tetramethylhexadecoxy)aniline.
| Compound Name | N-methyl-3,4-bis(3,7,11,15-tetramethylhexadecoxy)aniline |
|---|---|
| PubChem CID | 22974817 |
| Molecular Formula | C47H89NO2 |
| Molecular Weight | 700.23 g/mol |
| Exact Mass | 699.69 |
| IUPAC Name | N-methyl-3,4-bis(3,7,11,15-tetramethylhexadecoxy)aniline |
| SMILES | CNc1ccc(OCCC(C)CCCC(C)CCCC(C)CCCC(C)C)c(OCCC(C)CCCC(C)CCCC(C)CCCC(C)C)c1 |
| InChI | InChI=1S/C47H89NO2/c1-37(2)18-12-20-39(5)22-14-24-41(7)26-16-28-43(9)32-34-49-46-31-30-45(48-11)36-47(46)50-35-33-44(10)29-17-27-42(8)25-15-23-40(6)21-13-19-38(3)4/h30-31,36-44,48H,12-29,32-35H2,1-11H3 |
| InChIKey | JXZJKXGPBXTULU-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.23 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|