C36H67NO3 — CID 72799399
3,4,5-tris(3,7-dimethyloctoxy)aniline (PubChem CID 72799399) has the molecular formula C36H67NO3 and a molecular weight of 561.94 g/mol. Its IUPAC name is 3,4,5-tris(3,7-dimethyloctoxy)aniline.
| Compound Name | 3,4,5-tris(3,7-dimethyloctoxy)aniline |
|---|---|
| PubChem CID | 72799399 |
| Molecular Formula | C36H67NO3 |
| Molecular Weight | 561.94 g/mol |
| Exact Mass | 561.51 |
| IUPAC Name | 3,4,5-tris(3,7-dimethyloctoxy)aniline |
| SMILES | CC(C)CCCC(C)CCOc1cc(N)cc(OCCC(C)CCCC(C)C)c1OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C36H67NO3/c1-27(2)13-10-16-30(7)19-22-38-34-25-33(37)26-35(39-23-20-31(8)17-11-14-28(3)4)36(34)40-24-21-32(9)18-12-15-29(5)6/h25-32H,10-24,37H2,1-9H3 |
| InChIKey | JMWLOBMLDGXQHV-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.94 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|