C19H30Br2O2 — CID 98126089
1,4-bis(bromomethyl)-2-[(3S)-3,7-dimethyloctoxy]-5-methoxybenzene (PubChem CID 98126089) has the molecular formula C19H30Br2O2 and a molecular weight of 450.26 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)-2-[(3S)-3,7-dimethyloctoxy]-5-methoxybenzene.
| Compound Name | 1,4-bis(bromomethyl)-2-[(3S)-3,7-dimethyloctoxy]-5-methoxybenzene |
|---|---|
| PubChem CID | 98126089 |
| Molecular Formula | C19H30Br2O2 |
| Molecular Weight | 450.26 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 1,4-bis(bromomethyl)-2-[(3S)-3,7-dimethyloctoxy]-5-methoxybenzene |
| SMILES | COc1cc(CBr)c(OCC[C@@H](C)CCCC(C)C)cc1CBr |
| InChI | InChI=1S/C19H30Br2O2/c1-14(2)6-5-7-15(3)8-9-23-19-11-16(12-20)18(22-4)10-17(19)13-21/h10-11,14-15H,5-9,12-13H2,1-4H3/t15-/m0/s1 |
| InChIKey | DOKSAXJBKYCNRE-HNNXBMFYSA-N |
| XLogP | 6.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.26 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|