C37H46Br2O6 — CID 90703058
1,4-bis[2-(4-bromo-2,5-dimethoxyphenyl)ethenyl]-2-(3,7-dimethyloctoxy)-5-methoxybenzene (PubChem CID 90703058) has the molecular formula C37H46Br2O6 and a molecular weight of 746.58 g/mol. Its IUPAC name is 1,4-bis[2-(4-bromo-2,5-dimethoxyphenyl)ethenyl]-2-(3,7-dimethyloctoxy)-5-methoxybenzene.
| Compound Name | 1,4-bis[2-(4-bromo-2,5-dimethoxyphenyl)ethenyl]-2-(3,7-dimethyloctoxy)-5-methoxybenzene |
|---|---|
| PubChem CID | 90703058 |
| Molecular Formula | C37H46Br2O6 |
| Molecular Weight | 746.58 g/mol |
| Exact Mass | 744.17 |
| IUPAC Name | 1,4-bis[2-(4-bromo-2,5-dimethoxyphenyl)ethenyl]-2-(3,7-dimethyloctoxy)-5-methoxybenzene |
| SMILES | COc1cc(C=Cc2cc(OCCC(C)CCCC(C)C)c(C=Cc3cc(OC)c(Br)cc3OC)cc2OC)c(OC)cc1Br |
| InChI | InChI=1S/C37H46Br2O6/c1-24(2)10-9-11-25(3)16-17-45-35-19-26(12-13-27-20-36(43-7)30(38)22-33(27)41-5)32(40-4)18-29(35)15-14-28-21-37(44-8)31(39)23-34(28)42-6/h12-15,18-25H,9-11,16-17H2,1-8H3 |
| InChIKey | WOBLFQYPQKLPIK-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.58 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|