C29H34B2O2S2 — CID 89078623
CID 89078623 (PubChem CID 89078623) has the molecular formula C29H34B2O2S2 and a molecular weight of 500.35 g/mol.
| Compound Name | CID 89078623 |
|---|---|
| PubChem CID | 89078623 |
| Molecular Formula | C29H34B2O2S2 |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(/C=C/c2cc(OCCC(C)CCCC(C)C)c(/C=C/c3ccc([B])s3)cc2OC)s1 |
| InChI | InChI=1S/C29H34B2O2S2/c1-20(2)6-5-7-21(3)16-17-33-27-19-22(8-10-24-12-14-28(30)34-24)26(32-4)18-23(27)9-11-25-13-15-29(31)35-25/h8-15,18-21H,5-7,16-17H2,1-4H3/b10-8+,11-9+ |
| InChIKey | TVSJWVPOHVIOBC-GFULKKFKSA-N |
| XLogP | 6.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|