C78H132O6 — CID 11320772
2,3,6,7,10,11-hexakis(3,7-dimethyloctoxy)triphenylene (PubChem CID 11320772) has the molecular formula C78H132O6 and a molecular weight of 1165.91 g/mol. Its IUPAC name is 2,3,6,7,10,11-hexakis(3,7-dimethyloctoxy)triphenylene.
| Compound Name | 2,3,6,7,10,11-hexakis(3,7-dimethyloctoxy)triphenylene |
|---|---|
| PubChem CID | 11320772 |
| Molecular Formula | C78H132O6 |
| Molecular Weight | 1165.91 g/mol |
| Exact Mass | 1165.00 |
| IUPAC Name | 2,3,6,7,10,11-hexakis(3,7-dimethyloctoxy)triphenylene |
| SMILES | CC(C)CCCC(C)CCOc1cc2c3cc(OCCC(C)CCCC(C)C)c(OCCC(C)CCCC(C)C)cc3c3cc(OCCC(C)CCCC(C)C)c(OCCC(C)CCCC(C)C)cc3c2cc1OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C78H132O6/c1-55(2)25-19-31-61(13)37-43-79-73-49-67-68(50-74(73)80-44-38-62(14)32-20-26-56(3)4)70-52-76(82-46-40-64(16)34-22-28-58(7)8)78(84-48-42-66(18)36-24-30-60(11)12)54-72(70)71-53-77(83-47-41-65(17)35-23-29-59(9)10)75(51-69(67)71)81-45-39-63(15)33-21-27-57(5)6/h49-66H,19-48H2,1-18H3 |
| InChIKey | WSHXRDYCQMLHTJ-UHFFFAOYSA-N |
| XLogP | 24.53 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1165.91 |
| LogP ≤ 5 | 24.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|