C30H48N2O2 — CID 5060018
2-[4-(cyanomethyl)-2,5-bis(3,7-dimethyloctoxy)phenyl]acetonitrile (PubChem CID 5060018) has the molecular formula C30H48N2O2 and a molecular weight of 468.73 g/mol. Its IUPAC name is 2-[4-(cyanomethyl)-2,5-bis(3,7-dimethyloctoxy)phenyl]acetonitrile.
| Compound Name | 2-[4-(cyanomethyl)-2,5-bis(3,7-dimethyloctoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 5060018 |
| Molecular Formula | C30H48N2O2 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.37 |
| IUPAC Name | 2-[4-(cyanomethyl)-2,5-bis(3,7-dimethyloctoxy)phenyl]acetonitrile |
| SMILES | CC(C)CCCC(C)CCOc1cc(CC#N)c(OCCC(C)CCCC(C)C)cc1CC#N |
| InChI | InChI=1S/C30H48N2O2/c1-23(2)9-7-11-25(5)15-19-33-29-21-28(14-18-32)30(22-27(29)13-17-31)34-20-16-26(6)12-8-10-24(3)4/h21-26H,7-16,19-20H2,1-6H3 |
| InChIKey | KGJJVMVPAVTWCT-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |