C34H50O2S2 — CID 123954755
3-[4,5-bis(3,7-dimethyloctoxy)-2-thiophen-3-ylphenyl]thiophene (PubChem CID 123954755) has the molecular formula C34H50O2S2 and a molecular weight of 554.91 g/mol. Its IUPAC name is 3-[4,5-bis(3,7-dimethyloctoxy)-2-thiophen-3-ylphenyl]thiophene.
| Compound Name | 3-[4,5-bis(3,7-dimethyloctoxy)-2-thiophen-3-ylphenyl]thiophene |
|---|---|
| PubChem CID | 123954755 |
| Molecular Formula | C34H50O2S2 |
| Molecular Weight | 554.91 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | 3-[4,5-bis(3,7-dimethyloctoxy)-2-thiophen-3-ylphenyl]thiophene |
| SMILES | CC(C)CCCC(C)CCOc1cc(-c2ccsc2)c(-c2ccsc2)cc1OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C34H50O2S2/c1-25(2)9-7-11-27(5)13-17-35-33-21-31(29-15-19-37-23-29)32(30-16-20-38-24-30)22-34(33)36-18-14-28(6)12-8-10-26(3)4/h15-16,19-28H,7-14,17-18H2,1-6H3 |
| InChIKey | WUQDSJZCEMWXQM-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.91 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |