C27H46Cl2O2S2 — CID 11261190
1-[[2-(3,7-dimethyloctoxy)-5-methoxy-4-(thiolan-1-ium-1-ylmethyl)phenyl]methyl]thiolan-1-ium dichloride (PubChem CID 11261190) has the molecular formula C27H46Cl2O2S2 and a molecular weight of 537.70 g/mol. Its IUPAC name is 1-[[2-(3,7-dimethyloctoxy)-5-methoxy-4-(thiolan-1-ium-1-ylmethyl)phenyl]methyl]thiolan-1-ium dichloride.
| Compound Name | 1-[[2-(3,7-dimethyloctoxy)-5-methoxy-4-(thiolan-1-ium-1-ylmethyl)phenyl]methyl]thiolan-1-ium dichloride |
|---|---|
| PubChem CID | 11261190 |
| Molecular Formula | C27H46Cl2O2S2 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 1-[[2-(3,7-dimethyloctoxy)-5-methoxy-4-(thiolan-1-ium-1-ylmethyl)phenyl]methyl]thiolan-1-ium dichloride |
| SMILES | COc1cc(C[S+]2CCCC2)c(OCCC(C)CCCC(C)C)cc1C[S+]1CCCC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C27H46O2S2.2ClH/c1-22(2)10-9-11-23(3)12-13-29-27-19-24(20-30-14-5-6-15-30)26(28-4)18-25(27)21-31-16-7-8-17-31;;/h18-19,22-23H,5-17,20-21H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | OKZQTFDVEQFISI-UHFFFAOYSA-L |
| XLogP | 0.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|