C27H48O8P2 — CID 58749963
1-[diethoxy(phosphoroso)methyl]-4-(diethoxyphosphorylmethyl)-5-(3,7-dimethyloctoxy)-2-methoxybenzene (PubChem CID 58749963) has the molecular formula C27H48O8P2 and a molecular weight of 562.62 g/mol. Its IUPAC name is 1-[diethoxy(phosphoroso)methyl]-4-(diethoxyphosphorylmethyl)-5-(3,7-dimethyloctoxy)-2-methoxybenzene.
| Compound Name | 1-[diethoxy(phosphoroso)methyl]-4-(diethoxyphosphorylmethyl)-5-(3,7-dimethyloctoxy)-2-methoxybenzene |
|---|---|
| PubChem CID | 58749963 |
| Molecular Formula | C27H48O8P2 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 1-[diethoxy(phosphoroso)methyl]-4-(diethoxyphosphorylmethyl)-5-(3,7-dimethyloctoxy)-2-methoxybenzene |
| SMILES | CCOC(OCC)(P=O)c1cc(OCCC(C)CCCC(C)C)c(CP(=O)(OCC)OCC)cc1OC |
| InChI | InChI=1S/C27H48O8P2/c1-9-32-27(36-28,33-10-2)24-19-25(31-17-16-22(7)15-13-14-21(5)6)23(18-26(24)30-8)20-37(29,34-11-3)35-12-4/h18-19,21-22H,9-17,20H2,1-8H3 |
| InChIKey | JZYRVEMBRJDINH-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|