C15H22Cl2O2 — CID 134896794
1,4-bis(chloromethyl)-2-methoxy-5-(4-methylpentoxy)benzene (PubChem CID 134896794) has the molecular formula C15H22Cl2O2 and a molecular weight of 305.25 g/mol. Its IUPAC name is 1,4-bis(chloromethyl)-2-methoxy-5-(4-methylpentoxy)benzene.
| Compound Name | 1,4-bis(chloromethyl)-2-methoxy-5-(4-methylpentoxy)benzene |
|---|---|
| PubChem CID | 134896794 |
| Molecular Formula | C15H22Cl2O2 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1,4-bis(chloromethyl)-2-methoxy-5-(4-methylpentoxy)benzene |
| SMILES | COc1cc(CCl)c(OCCCC(C)C)cc1CCl |
| InChI | InChI=1S/C15H22Cl2O2/c1-11(2)5-4-6-19-15-8-12(9-16)14(18-3)7-13(15)10-17/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | QVYLXCLQONWPLW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|