C27H47ClO5S — CID 11306921
1-(chloromethyl)-5-(3,7-dimethoxyoctoxy)-2-methoxy-4-(octylsulfinylmethyl)benzene (PubChem CID 11306921) has the molecular formula C27H47ClO5S and a molecular weight of 519.19 g/mol. Its IUPAC name is 1-(chloromethyl)-5-(3,7-dimethoxyoctoxy)-2-methoxy-4-(octylsulfinylmethyl)benzene.
| Compound Name | 1-(chloromethyl)-5-(3,7-dimethoxyoctoxy)-2-methoxy-4-(octylsulfinylmethyl)benzene |
|---|---|
| PubChem CID | 11306921 |
| Molecular Formula | C27H47ClO5S |
| Molecular Weight | 519.19 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 1-(chloromethyl)-5-(3,7-dimethoxyoctoxy)-2-methoxy-4-(octylsulfinylmethyl)benzene |
| SMILES | CCCCCCCCS(=O)Cc1cc(OC)c(CCl)cc1OCCC(CCCC(C)OC)OC |
| InChI | InChI=1S/C27H47ClO5S/c1-6-7-8-9-10-11-17-34(29)21-24-19-26(32-5)23(20-28)18-27(24)33-16-15-25(31-4)14-12-13-22(2)30-3/h18-19,22,25H,6-17,20-21H2,1-5H3 |
| InChIKey | DVWATPYOWDKDPR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.19 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|