C24H40Cl2O2 — CID 20769170
1,4-bis(chloromethyl)-3-deuterio-2,5-dioctoxybenzene (PubChem CID 20769170) has the molecular formula C24H40Cl2O2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 1,4-bis(chloromethyl)-3-deuterio-2,5-dioctoxybenzene.
| Compound Name | 1,4-bis(chloromethyl)-3-deuterio-2,5-dioctoxybenzene |
|---|---|
| PubChem CID | 20769170 |
| Molecular Formula | C24H40Cl2O2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 1,4-bis(chloromethyl)-3-deuterio-2,5-dioctoxybenzene |
| SMILES | [2H]c1c(CCl)c(OCCCCCCCC)cc(CCl)c1OCCCCCCCC |
| InChI | InChI=1S/C24H40Cl2O2/c1-3-5-7-9-11-13-15-27-23-17-22(20-26)24(18-21(23)19-25)28-16-14-12-10-8-6-4-2/h17-18H,3-16,19-20H2,1-2H3/i17D |
| InChIKey | MPZDRVMBDAPSSQ-OKWSDYJOSA-N |
| XLogP | 8.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|