C11H13ClF2O2 — CID 18755417
1-(3-chloropropoxymethyl)-4,5-difluoro-2-methoxybenzene (PubChem CID 18755417) has the molecular formula C11H13ClF2O2 and a molecular weight of 250.67 g/mol. Its IUPAC name is 1-(3-chloropropoxymethyl)-4,5-difluoro-2-methoxybenzene.
| Compound Name | 1-(3-chloropropoxymethyl)-4,5-difluoro-2-methoxybenzene |
|---|---|
| PubChem CID | 18755417 |
| Molecular Formula | C11H13ClF2O2 |
| Molecular Weight | 250.67 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1-(3-chloropropoxymethyl)-4,5-difluoro-2-methoxybenzene |
| SMILES | COc1cc(F)c(F)cc1COCCCCl |
| InChI | InChI=1S/C11H13ClF2O2/c1-15-11-6-10(14)9(13)5-8(11)7-16-4-2-3-12/h5-6H,2-4,7H2,1H3 |
| InChIKey | MLLHYHSQHIULDN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|