C11H15ClO3 — CID 64867522
1-(2-chloroethyl)-2,4,5-trimethoxybenzene (PubChem CID 64867522) has the molecular formula C11H15ClO3 and a molecular weight of 230.69 g/mol. Its IUPAC name is 1-(2-chloroethyl)-2,4,5-trimethoxybenzene.
| Compound Name | 1-(2-chloroethyl)-2,4,5-trimethoxybenzene |
|---|---|
| PubChem CID | 64867522 |
| Molecular Formula | C11H15ClO3 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-(2-chloroethyl)-2,4,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(OC)cc1CCCl |
| InChI | InChI=1S/C11H15ClO3/c1-13-9-7-11(15-3)10(14-2)6-8(9)4-5-12/h6-7H,4-5H2,1-3H3 |
| InChIKey | IEUDNFZAKXJTPZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|