C9H10Cl2O2 — CID 82645011
1-chloro-5-(chloromethyl)-2,4-dimethoxybenzene (PubChem CID 82645011) has the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. Its IUPAC name is 1-chloro-5-(chloromethyl)-2,4-dimethoxybenzene.
| Compound Name | 1-chloro-5-(chloromethyl)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 82645011 |
| Molecular Formula | C9H10Cl2O2 |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 1-chloro-5-(chloromethyl)-2,4-dimethoxybenzene |
| SMILES | COc1cc(OC)c(CCl)cc1Cl |
| InChI | InChI=1S/C9H10Cl2O2/c1-12-8-4-9(13-2)7(11)3-6(8)5-10/h3-4H,5H2,1-2H3 |
| InChIKey | AQRLLLWUOWDOSD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|