C10H13ClO2 — CID 71132798
1-chloro-4-ethyl-2,5-dimethoxybenzene (PubChem CID 71132798) has the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. Its IUPAC name is 1-chloro-4-ethyl-2,5-dimethoxybenzene.
| Compound Name | 1-chloro-4-ethyl-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 71132798 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1-chloro-4-ethyl-2,5-dimethoxybenzene |
| SMILES | CCc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C10H13ClO2/c1-4-7-5-10(13-3)8(11)6-9(7)12-2/h5-6H,4H2,1-3H3 |
| InChIKey | ZOFIROKVACDJIR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |