C10H14ClNO3 — CID 117335514
1-(4-chloro-2,5-dimethoxyphenyl)-N-methoxymethanamine (PubChem CID 117335514) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-N-methoxymethanamine.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117335514 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-N-methoxymethanamine |
| SMILES | CONCc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C10H14ClNO3/c1-13-9-5-8(11)10(14-2)4-7(9)6-12-15-3/h4-5,12H,6H2,1-3H3 |
| InChIKey | RBITVWNICHDYIC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|