C9H11Cl2NO2 — CID 117344115
1-(3,5-dichloro-2-methoxyphenyl)-N-methoxymethanamine (PubChem CID 117344115) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-methoxyphenyl)-N-methoxymethanamine.
| Compound Name | 1-(3,5-dichloro-2-methoxyphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117344115 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 1-(3,5-dichloro-2-methoxyphenyl)-N-methoxymethanamine |
| SMILES | CONCc1cc(Cl)cc(Cl)c1OC |
| InChI | InChI=1S/C9H11Cl2NO2/c1-13-9-6(5-12-14-2)3-7(10)4-8(9)11/h3-4,12H,5H2,1-2H3 |
| InChIKey | BNYQESLFNBZVBS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|